AMPIm-6-GABA
N6-(4-carboxybutyl)-adenosine 5'-monophosphate
Download Sdf File

ID: 483.1.1
Molecular formula: C17H21N7O8P-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -30 V
Collision energy: -55 eV
Canonical smiles: O=C(O)CCCNc1ncnc2c1ncn2C1OC(COP(=O)([O-])n2ccnc2)C(O)C1O
| m/z |
67 |
79 |
81 |
96 |
97 |
121 |
132 |
133 |
134 |
146 |
147 |
174 |
175 |
176 |
193 |
| intensity |
1 |
100 |
1 |
1 |
1 |
3 |
1 |
10 |
13 |
1 |
63 |
4 |
1 |
11 |
3 |
| m/z |
200 |
201 |
202 |
220 |
243 |
261 |
414 |
482 |
| intensity |
1 |
1 |
81 |
17 |
1 |
6 |
1 |
23 |