AMP_1x18O
adenosine 5’-([18O]-monophosphate)
Download Sdf File

ID: 349.3.1
Molecular formula: C10H13N5O7P-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -45 V
Collision energy: -40 eV
Canonical smiles: Nc1ncnc2c1ncn2C1OC(COP(=O)([O-])[18OH])C(O)C1O
| m/z |
79 |
81 |
99 |
101 |
107 |
134 |
141 |
152 |
153 |
194 |
195 |
213 |
348 |
| intensity |
5 |
100 |
50 |
1 |
3 |
40 |
3 |
4 |
5 |
1 |
3 |
4 |
20 |