GTP_18O
Guanosine 5′-(γ[18O]triphosphate)
Download Sdf File

ID: 525.2.1
Molecular formula: C10H15N5O14P3-
Instrument: Q TRAP 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -30 V
Collision energy: -40 eV
Canonical smiles: Nc1nc2c(ncn2C2OC(COP(=O)(O)OP(=O)(O)OP(=O)([O-])[18OH])C(O)C2O)c(=O)[nH]1
| m/z |
79 |
81 |
150 |
159 |
161 |
175 |
177 |
179 |
230 |
232 |
239 |
241 |
255 |
261 |
273 |
275 |
326 |
344 |
| intensity |
9 |
3 |
13 |
32 |
100 |
5 |
6 |
21 |
7 |
2 |
1 |
11 |
1 |
2 |
9 |
6 |
1 |
6 |
| m/z |
346 |
373 |
424 |
426 |
442 |
444 |
506 |
524 |
| intensity |
2 |
2 |
22 |
18 |
5 |
6 |
5 |
21 |