GMPNH2(CH2)4N3
N-(4-aminobutyl) guanosine 5’-phosphoroamidate
Download Sdf File

ID: 433.1.1
Molecular formula: C14H23N7O7P-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -30 V
Collision energy: -50 eV
Canonical smiles: NCCCCNP(=O)([O-])OCC1OC(n2cnc3c2nc(N)[nH]c3=O)C(O)C1O
| m/z |
78 |
79 |
97 |
107 |
108 |
113 |
133 |
149 |
150 |
164 |
167 |
| intensity |
2 |
45 |
5 |
19 |
9 |
1 |
62 |
6 |
100 |
2 |
4 |
| m/z |
191 |
192 |
209 |
239 |
282 |
344 |
389 |
432 |
| intensity |
1 |
5 |
5 |
7 |
8 |
1 |
1 |
8 |