3’(2’)Mant-GMP
2’-/3’- Methylanthraniloyl guanosine 5’-monophosphate
Download Sdf File

ID: 524.1.1
Molecular formula: C20H24N6O9P-
Instrument: API 3200
Scan type: MS2
Ionization: ESI (-)
Declustering potential: -20 V
Collision energy: -50 eV
Canonical smiles: CNc1ccccc1C(=O)OC1C(O)C(COP(=O)([O-])O)OC1n1cnc2c1nc(N(C)C)[nH]c2=O
| m/z |
79 |
97 |
106 |
133 |
150 |
151 |
163 |
175 |
178 |
193 |
212 |
326 |
372 |
523 |
| intensity |
100 |
69 |
2 |
11 |
14 |
4 |
3 |
2 |
88 |
6 |
1 |
2 |
36 |
22 |